C23H25N7 — CID 167006627
4-[2-[3-(benzotriazol-1-yl)phenyl]azepan-1-yl]-6-methylpyrimidin-2-amine (PubChem CID 167006627) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[2-[3-(benzotriazol-1-yl)phenyl]azepan-1-yl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-[2-[3-(benzotriazol-1-yl)phenyl]azepan-1-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 167006627 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 4-[2-[3-(benzotriazol-1-yl)phenyl]azepan-1-yl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCCCC2c2cccc(-n3nnc4ccccc43)c2)nc(N)n1 |
| InChI | InChI=1S/C23H25N7/c1-16-14-22(26-23(24)25-16)29-13-6-2-3-11-20(29)17-8-7-9-18(15-17)30-21-12-5-4-10-19(21)27-28-30/h4-5,7-10,12,14-15,20H,2-3,6,11,13H2,1H3,(H2,24,25,26) |
| InChIKey | OCFLOWCPNNKHQH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |