C25H27N3O5 — CID 118333024
ethyl (E)-3-(3,5-dimethoxyphenyl)-3-(7-morpholin-4-yl-1,5-naphthyridin-2-yl)prop-2-enoate (PubChem CID 118333024) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl (E)-3-(3,5-dimethoxyphenyl)-3-(7-morpholin-4-yl-1,5-naphthyridin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(3,5-dimethoxyphenyl)-3-(7-morpholin-4-yl-1,5-naphthyridin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 118333024 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | ethyl (E)-3-(3,5-dimethoxyphenyl)-3-(7-morpholin-4-yl-1,5-naphthyridin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\c1cc(OC)cc(OC)c1)c1ccc2ncc(N3CCOCC3)cc2n1 |
| InChI | InChI=1S/C25H27N3O5/c1-4-33-25(29)15-21(17-11-19(30-2)14-20(12-17)31-3)22-5-6-23-24(27-22)13-18(16-26-23)28-7-9-32-10-8-28/h5-6,11-16H,4,7-10H2,1-3H3/b21-15+ |
| InChIKey | BBIHYOSDMSDFHC-RCCKNPSSSA-N |
| XLogP | 3.48 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|