C18H30O3 — CID 11833306
(2Z,4E,8R)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenona-2,4-dien-1-ol (PubChem CID 11833306) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2Z,4E,8R)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenona-2,4-dien-1-ol.
| Compound Name | (2Z,4E,8R)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenona-2,4-dien-1-ol |
|---|---|
| PubChem CID | 11833306 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (2Z,4E,8R)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,8-trimethyl-6-methylidenenona-2,4-dien-1-ol |
| SMILES | C=C(/C=C(C)/C(C)=C\CO)C[C@@H](C)C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H30O3/c1-13(10-16(4)15(3)7-8-19)9-14(2)11-17-12-20-18(5,6)21-17/h7,10,14,17,19H,1,8-9,11-12H2,2-6H3/b15-7-,16-10+/t14-,17-/m1/s1 |
| InChIKey | FRYCSXVKHZGKAO-FUBZUXHWSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|