C20H36O3 — CID 75296788
2,6,10-trimethyl-13-(2-methyl-1,3-dioxolan-2-yl)trideca-5,10-dien-4-ol (PubChem CID 75296788) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2,6,10-trimethyl-13-(2-methyl-1,3-dioxolan-2-yl)trideca-5,10-dien-4-ol.
| Compound Name | 2,6,10-trimethyl-13-(2-methyl-1,3-dioxolan-2-yl)trideca-5,10-dien-4-ol |
|---|---|
| PubChem CID | 75296788 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 2,6,10-trimethyl-13-(2-methyl-1,3-dioxolan-2-yl)trideca-5,10-dien-4-ol |
| SMILES | CC(=CCCC1(C)OCCO1)CCCC(C)=CC(O)CC(C)C |
| InChI | InChI=1S/C20H36O3/c1-16(2)14-19(21)15-18(4)9-6-8-17(3)10-7-11-20(5)22-12-13-23-20/h10,15-16,19,21H,6-9,11-14H2,1-5H3 |
| InChIKey | XBEAKQYTHLRTMG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|