C14H28O3 — CID 134892497
(E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-ol (PubChem CID 134892497) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is (E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-ol.
| Compound Name | (E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-ol |
|---|---|
| PubChem CID | 134892497 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-ol |
| SMILES | CCCC/C(C)=C/[C@H](O)[C@@H](OCOC)C(C)C |
| InChI | InChI=1S/C14H28O3/c1-6-7-8-12(4)9-13(15)14(11(2)3)17-10-16-5/h9,11,13-15H,6-8,10H2,1-5H3/b12-9+/t13-,14-/m0/s1 |
| InChIKey | YWAQCFBOGSSTPR-ZJTSMVRJSA-N |
| XLogP | 3.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|