C12H22O4 — CID 46849798
(E,4R,5R)-2,4-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)hex-2-ene-1,5-diol (PubChem CID 46849798) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (E,4R,5R)-2,4-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)hex-2-ene-1,5-diol.
| Compound Name | (E,4R,5R)-2,4-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)hex-2-ene-1,5-diol |
|---|---|
| PubChem CID | 46849798 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (E,4R,5R)-2,4-dimethyl-6-(2-methyl-1,3-dioxolan-2-yl)hex-2-ene-1,5-diol |
| SMILES | C/C(=C\[C@@H](C)[C@H](O)CC1(C)OCCO1)CO |
| InChI | InChI=1S/C12H22O4/c1-9(8-13)6-10(2)11(14)7-12(3)15-4-5-16-12/h6,10-11,13-14H,4-5,7-8H2,1-3H3/b9-6+/t10-,11-/m1/s1 |
| InChIKey | MPBJPJACBRAMCU-WHTZOINASA-N |
| XLogP | 1.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|