C19H28BrF2N3O7S — CID 118334647
2-amino-5-[[(2R)-3-[(Z)-1-bromo-1,1-difluoro-4-oxonon-2-en-3-yl]sulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 118334647) has the molecular formula C19H28BrF2N3O7S and a molecular weight of 560.41 g/mol. Its IUPAC name is 2-amino-5-[[(2R)-3-[(Z)-1-bromo-1,1-difluoro-4-oxonon-2-en-3-yl]sulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[(2R)-3-[(Z)-1-bromo-1,1-difluoro-4-oxonon-2-en-3-yl]sulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118334647 |
| Molecular Formula | C19H28BrF2N3O7S |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 2-amino-5-[[(2R)-3-[(Z)-1-bromo-1,1-difluoro-4-oxonon-2-en-3-yl]sulfanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCCCC(=O)/C(=C/C(F)(F)Br)SC[C@H](NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H28BrF2N3O7S/c1-2-3-4-5-13(26)14(8-19(20,21)22)33-10-12(17(30)24-9-16(28)29)25-15(27)7-6-11(23)18(31)32/h8,11-12H,2-7,9-10,23H2,1H3,(H,24,30)(H,25,27)(H,28,29)(H,31,32)/b14-8-/t11?,12-/m0/s1 |
| InChIKey | JSGUYGIFNLFJOB-GTNLGZKLSA-N |
| XLogP | 1.62 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|