C13H24N2O5 — CID 118334726
N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]prop-2-enamide (PubChem CID 118334726) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]prop-2-enamide.
| Compound Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 118334726 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-[2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCOCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C13H24N2O5/c1-3-13(17)15-5-7-19-9-11-20-10-8-18-6-4-14-12(2)16/h3H,1,4-11H2,2H3,(H,14,16)(H,15,17) |
| InChIKey | LJKCTAREOMCVEV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|