C10H13IO3 — CID 11833777
ethyl 4-iodo-1,3-dimethyl-2-oxocyclopent-3-ene-1-carboxylate (PubChem CID 11833777) has the molecular formula C10H13IO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is ethyl 4-iodo-1,3-dimethyl-2-oxocyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 4-iodo-1,3-dimethyl-2-oxocyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11833777 |
| Molecular Formula | C10H13IO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | ethyl 4-iodo-1,3-dimethyl-2-oxocyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(I)=C(C)C1=O |
| InChI | InChI=1S/C10H13IO3/c1-4-14-9(13)10(3)5-7(11)6(2)8(10)12/h4-5H2,1-3H3 |
| InChIKey | FCBCZCIAYOXSIJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|