C27H36N6O4 — CID 118338322
methyl 2-amino-4-(1-cyclohexylbenzimidazol-5-yl)-6-[3-(dimethylamino)propyl-methylamino]-3-nitrobenzoate (PubChem CID 118338322) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is methyl 2-amino-4-(1-cyclohexylbenzimidazol-5-yl)-6-[3-(dimethylamino)propyl-methylamino]-3-nitrobenzoate.
| Compound Name | methyl 2-amino-4-(1-cyclohexylbenzimidazol-5-yl)-6-[3-(dimethylamino)propyl-methylamino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 118338322 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | methyl 2-amino-4-(1-cyclohexylbenzimidazol-5-yl)-6-[3-(dimethylamino)propyl-methylamino]-3-nitrobenzoate |
| SMILES | COC(=O)c1c(N(C)CCCN(C)C)cc(-c2ccc3c(c2)ncn3C2CCCCC2)c([N+](=O)[O-])c1N |
| InChI | InChI=1S/C27H36N6O4/c1-30(2)13-8-14-31(3)23-16-20(26(33(35)36)25(28)24(23)27(34)37-4)18-11-12-22-21(15-18)29-17-32(22)19-9-6-5-7-10-19/h11-12,15-17,19H,5-10,13-14,28H2,1-4H3 |
| InChIKey | SSCXGQYMHHMYMG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|