C25H23N3O4 — CID 164611540
methyl 2-[4-[(4-nitro-2-propylbenzimidazol-1-yl)methyl]phenyl]benzoate (PubChem CID 164611540) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is methyl 2-[4-[(4-nitro-2-propylbenzimidazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[(4-nitro-2-propylbenzimidazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 164611540 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | methyl 2-[4-[(4-nitro-2-propylbenzimidazol-1-yl)methyl]phenyl]benzoate |
| SMILES | CCCc1nc2c([N+](=O)[O-])cccc2n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-3-7-23-26-24-21(10-6-11-22(24)28(30)31)27(23)16-17-12-14-18(15-13-17)19-8-4-5-9-20(19)25(29)32-2/h4-6,8-15H,3,7,16H2,1-2H3 |
| InChIKey | HFRXCHIUSCWUIQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|