C19H13F3N4OS2 — CID 118340470
N-[5-[1-ethyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]thiophen-2-yl]-N-(2,4,6-trifluorophenyl)formamide (PubChem CID 118340470) has the molecular formula C19H13F3N4OS2 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[5-[1-ethyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]thiophen-2-yl]-N-(2,4,6-trifluorophenyl)formamide.
| Compound Name | N-[5-[1-ethyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]thiophen-2-yl]-N-(2,4,6-trifluorophenyl)formamide |
|---|---|
| PubChem CID | 118340470 |
| Molecular Formula | C19H13F3N4OS2 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-[5-[1-ethyl-3-(1,3-thiazol-2-yl)pyrazol-5-yl]thiophen-2-yl]-N-(2,4,6-trifluorophenyl)formamide |
| SMILES | CCn1nc(-c2nccs2)cc1-c1ccc(N(C=O)c2c(F)cc(F)cc2F)s1 |
| InChI | InChI=1S/C19H13F3N4OS2/c1-2-26-15(9-14(24-26)19-23-5-6-28-19)16-3-4-17(29-16)25(10-27)18-12(21)7-11(20)8-13(18)22/h3-10H,2H2,1H3 |
| InChIKey | XVRMFTGLKCPELL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|