C19H14F4N2O2 — CID 118341131
8-fluoro-10-methyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one (PubChem CID 118341131) has the molecular formula C19H14F4N2O2 and a molecular weight of 378.33 g/mol. Its IUPAC name is 8-fluoro-10-methyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one.
| Compound Name | 8-fluoro-10-methyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
|---|---|
| PubChem CID | 118341131 |
| Molecular Formula | C19H14F4N2O2 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 8-fluoro-10-methyl-6-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-pyrazino[1,2-a]indol-1-one |
| SMILES | Cc1c2n(c3c(-c4ccc(OC(F)(F)F)cc4)cc(F)cc13)CCNC2=O |
| InChI | InChI=1S/C19H14F4N2O2/c1-10-14-8-12(20)9-15(17(14)25-7-6-24-18(26)16(10)25)11-2-4-13(5-3-11)27-19(21,22)23/h2-5,8-9H,6-7H2,1H3,(H,24,26) |
| InChIKey | LAJUJHCHDKCXIP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|