C13H15ClF2N2O2 — CID 118341316
N-[(1R)-1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 118341316) has the molecular formula C13H15ClF2N2O2 and a molecular weight of 304.72 g/mol. Its IUPAC name is N-[(1R)-1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | N-[(1R)-1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118341316 |
| Molecular Formula | C13H15ClF2N2O2 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-[(1R)-1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)c1cccc(Cl)c1F)C1CC(F)CN1 |
| InChI | InChI=1S/C13H15ClF2N2O2/c14-9-3-1-2-8(12(9)16)11(6-19)18-13(20)10-4-7(15)5-17-10/h1-3,7,10-11,17,19H,4-6H2,(H,18,20)/t7?,10?,11-/m0/s1 |
| InChIKey | LPEGZCHSGVCKOY-KKOQCAIRSA-N |
| XLogP | 1.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |