C27H28N6S — CID 118341947
4-[6-(3-aminophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-cyclohexylphenyl)pyrimidin-2-amine (PubChem CID 118341947) has the molecular formula C27H28N6S and a molecular weight of 468.63 g/mol. Its IUPAC name is 4-[6-(3-aminophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-cyclohexylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[6-(3-aminophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-cyclohexylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118341947 |
| Molecular Formula | C27H28N6S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[6-(3-aminophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-cyclohexylphenyl)pyrimidin-2-amine |
| SMILES | Nc1cccc(-c2nc3n(c2-c2ccnc(Nc4ccc(C5CCCCC5)cc4)n2)CCS3)c1 |
| InChI | InChI=1S/C27H28N6S/c28-21-8-4-7-20(17-21)24-25(33-15-16-34-27(33)32-24)23-13-14-29-26(31-23)30-22-11-9-19(10-12-22)18-5-2-1-3-6-18/h4,7-14,17-18H,1-3,5-6,15-16,28H2,(H,29,30,31) |
| InChIKey | IRWAKIYBFOKIKQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|