C26H32N6O4 — CID 118342503
2-amino-4-(2-cyclohexyl-3H-benzimidazol-5-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitrobenzamide (PubChem CID 118342503) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-amino-4-(2-cyclohexyl-3H-benzimidazol-5-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitrobenzamide.
| Compound Name | 2-amino-4-(2-cyclohexyl-3H-benzimidazol-5-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitrobenzamide |
|---|---|
| PubChem CID | 118342503 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-amino-4-(2-cyclohexyl-3H-benzimidazol-5-yl)-6-[(1-methylpyrrolidin-2-yl)methoxy]-3-nitrobenzamide |
| SMILES | CN1CCCC1COc1cc(-c2ccc3nc(C4CCCCC4)[nH]c3c2)c([N+](=O)[O-])c(N)c1C(N)=O |
| InChI | InChI=1S/C26H32N6O4/c1-31-11-5-8-17(31)14-36-21-13-18(24(32(34)35)23(27)22(21)25(28)33)16-9-10-19-20(12-16)30-26(29-19)15-6-3-2-4-7-15/h9-10,12-13,15,17H,2-8,11,14,27H2,1H3,(H2,28,33)(H,29,30) |
| InChIKey | LSXVFXQPYDLSMB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 153.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|