C15H22N2 — CID 118343614
N-[(4-ethenylphenyl)methyl]-3-(ethylideneamino)-N-methylpropan-1-amine (PubChem CID 118343614) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-[(4-ethenylphenyl)methyl]-3-(ethylideneamino)-N-methylpropan-1-amine.
| Compound Name | N-[(4-ethenylphenyl)methyl]-3-(ethylideneamino)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 118343614 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-[(4-ethenylphenyl)methyl]-3-(ethylideneamino)-N-methylpropan-1-amine |
| SMILES | C=Cc1ccc(CN(C)CCC/N=C/C)cc1 |
| InChI | InChI=1S/C15H22N2/c1-4-14-7-9-15(10-8-14)13-17(3)12-6-11-16-5-2/h4-5,7-10H,1,6,11-13H2,2-3H3/b16-5+ |
| InChIKey | LGMNZMVRVVRTRX-FZSIALSZSA-N |
| XLogP | 3.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|