C24H26ClN5O — CID 11834410
2-(4-benzylpiperazin-1-yl)-N-(furan-2-ylmethyl)quinazolin-4-amine;hydrochloride (PubChem CID 11834410) has the molecular formula C24H26ClN5O and a molecular weight of 435.96 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-(furan-2-ylmethyl)quinazolin-4-amine;hydrochloride.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-(furan-2-ylmethyl)quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 11834410 |
| Molecular Formula | C24H26ClN5O |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-(furan-2-ylmethyl)quinazolin-4-amine;hydrochloride |
| SMILES | Cl.c1ccc(CN2CCN(c3nc(NCc4ccco4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O.ClH/c1-2-7-19(8-3-1)18-28-12-14-29(15-13-28)24-26-22-11-5-4-10-21(22)23(27-24)25-17-20-9-6-16-30-20;/h1-11,16H,12-15,17-18H2,(H,25,26,27);1H |
| InChIKey | URASQJJESLYAKM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |