C33H27Cl3O2 — CID 118344150
methyl 2-[9-[2,2,2-trichloro-1-(9-ethylfluoren-9-yl)ethyl]fluoren-9-yl]acetate (PubChem CID 118344150) has the molecular formula C33H27Cl3O2 and a molecular weight of 561.94 g/mol. Its IUPAC name is methyl 2-[9-[2,2,2-trichloro-1-(9-ethylfluoren-9-yl)ethyl]fluoren-9-yl]acetate.
| Compound Name | methyl 2-[9-[2,2,2-trichloro-1-(9-ethylfluoren-9-yl)ethyl]fluoren-9-yl]acetate |
|---|---|
| PubChem CID | 118344150 |
| Molecular Formula | C33H27Cl3O2 |
| Molecular Weight | 561.94 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | methyl 2-[9-[2,2,2-trichloro-1-(9-ethylfluoren-9-yl)ethyl]fluoren-9-yl]acetate |
| SMILES | CCC1(C(C(Cl)(Cl)Cl)C2(CC(=O)OC)c3ccccc3-c3ccccc32)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H27Cl3O2/c1-3-31(25-16-8-4-12-21(25)22-13-5-9-17-26(22)31)30(33(34,35)36)32(20-29(37)38-2)27-18-10-6-14-23(27)24-15-7-11-19-28(24)32/h4-19,30H,3,20H2,1-2H3 |
| InChIKey | KEQBLOZWEOIUKU-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.94 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|