C31H34ClNO4 — CID 165341187
1-O-tert-butyl 4-O-methyl (2S)-2-[3-chloropropyl-(9-phenylfluoren-9-yl)amino]butanedioate (PubChem CID 165341187) has the molecular formula C31H34ClNO4 and a molecular weight of 520.07 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl (2S)-2-[3-chloropropyl-(9-phenylfluoren-9-yl)amino]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-methyl (2S)-2-[3-chloropropyl-(9-phenylfluoren-9-yl)amino]butanedioate |
|---|---|
| PubChem CID | 165341187 |
| Molecular Formula | C31H34ClNO4 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl (2S)-2-[3-chloropropyl-(9-phenylfluoren-9-yl)amino]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC(C)(C)C)N(CCCCl)C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H34ClNO4/c1-30(2,3)37-29(35)27(21-28(34)36-4)33(20-12-19-32)31(22-13-6-5-7-14-22)25-17-10-8-15-23(25)24-16-9-11-18-26(24)31/h5-11,13-18,27H,12,19-21H2,1-4H3/t27-/m0/s1 |
| InChIKey | HUGSYOZKZCOQEH-MHZLTWQESA-N |
| XLogP | 6.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|