C33H31NO4 — CID 10346060
dimethyl (2R,3R)-2-[benzyl-(9-phenylfluoren-9-yl)amino]-3-methylbutanedioate (PubChem CID 10346060) has the molecular formula C33H31NO4 and a molecular weight of 505.61 g/mol. Its IUPAC name is dimethyl (2R,3R)-2-[benzyl-(9-phenylfluoren-9-yl)amino]-3-methylbutanedioate.
| Compound Name | dimethyl (2R,3R)-2-[benzyl-(9-phenylfluoren-9-yl)amino]-3-methylbutanedioate |
|---|---|
| PubChem CID | 10346060 |
| Molecular Formula | C33H31NO4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | dimethyl (2R,3R)-2-[benzyl-(9-phenylfluoren-9-yl)amino]-3-methylbutanedioate |
| SMILES | COC(=O)[C@H](C)[C@H](C(=O)OC)N(Cc1ccccc1)C1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H31NO4/c1-23(31(35)37-2)30(32(36)38-3)34(22-24-14-6-4-7-15-24)33(25-16-8-5-9-17-25)28-20-12-10-18-26(28)27-19-11-13-21-29(27)33/h4-21,23,30H,22H2,1-3H3/t23-,30-/m1/s1 |
| InChIKey | PEWPNZBJHGCTKA-WVXBCFDCSA-N |
| XLogP | 5.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |