C22H19N5O6S — CID 11834486
4-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 11834486) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is 4-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11834486 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 4-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(-c2n[nH]c(=S)n2/N=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H19N5O6S/c1-30-18-10-13(11-19(31-2)20(18)32-3)21-24-25-22(34)26(21)23-12-14-8-9-17(33-14)15-6-4-5-7-16(15)27(28)29/h4-12H,1-3H3,(H,25,34)/b23-12+ |
| InChIKey | GQZKOHYZQUKUIO-FSJBWODESA-N |
| XLogP | 4.68 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|