C21H23Cl2N3O3 — CID 118345291
N-[4-[[5-[(E,3S)-3-acetamidobut-1-enyl]-2-pyridinyl]oxy]-3-chlorophenyl]-4-chlorobutanamide (PubChem CID 118345291) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is N-[4-[[5-[(E,3S)-3-acetamidobut-1-enyl]-2-pyridinyl]oxy]-3-chlorophenyl]-4-chlorobutanamide.
| Compound Name | N-[4-[[5-[(E,3S)-3-acetamidobut-1-enyl]-2-pyridinyl]oxy]-3-chlorophenyl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 118345291 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[4-[[5-[(E,3S)-3-acetamidobut-1-enyl]-2-pyridinyl]oxy]-3-chlorophenyl]-4-chlorobutanamide |
| SMILES | CC(=O)N[C@@H](C)/C=C/c1ccc(Oc2ccc(NC(=O)CCCCl)cc2Cl)nc1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c1-14(25-15(2)27)5-6-16-7-10-21(24-13-16)29-19-9-8-17(12-18(19)23)26-20(28)4-3-11-22/h5-10,12-14H,3-4,11H2,1-2H3,(H,25,27)(H,26,28)/b6-5+/t14-/m0/s1 |
| InChIKey | OTCHVEUSKZIIBD-GJBLVYBDSA-N |
| XLogP | 5.02 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|