C18H19ClN2O3 — CID 123244335
N-[(2S)-4-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]but-3-en-2-yl]acetamide (PubChem CID 123244335) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is N-[(2S)-4-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]but-3-en-2-yl]acetamide.
| Compound Name | N-[(2S)-4-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]but-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 123244335 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[(2S)-4-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]but-3-en-2-yl]acetamide |
| SMILES | COc1ccc(Cl)c(Oc2ccc(C=C[C@H](C)NC(C)=O)cn2)c1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12(21-13(2)22)4-5-14-6-9-18(20-11-14)24-17-10-15(23-3)7-8-16(17)19/h4-12H,1-3H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | PDXPIKDKFZFXPK-LBPRGKRZSA-N |
| XLogP | 4.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |