C18H23NO2 — CID 118347456
(2S)-2-amino-3-(3,5-dimethylphenyl)-3-(3-methoxyphenyl)propan-1-ol (PubChem CID 118347456) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,5-dimethylphenyl)-3-(3-methoxyphenyl)propan-1-ol.
| Compound Name | (2S)-2-amino-3-(3,5-dimethylphenyl)-3-(3-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 118347456 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2S)-2-amino-3-(3,5-dimethylphenyl)-3-(3-methoxyphenyl)propan-1-ol |
| SMILES | COc1cccc(C(c2cc(C)cc(C)c2)[C@H](N)CO)c1 |
| InChI | InChI=1S/C18H23NO2/c1-12-7-13(2)9-15(8-12)18(17(19)11-20)14-5-4-6-16(10-14)21-3/h4-10,17-18,20H,11,19H2,1-3H3/t17-,18?/m1/s1 |
| InChIKey | OKJIJDVEUGJABV-QNSVNVJESA-N |
| XLogP | 2.76 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |