C16H9Cl3N4O3S2 — CID 118352323
N-[(4-chlorophenyl)methyl]-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-1,3-thiazole-2-carboxamide (PubChem CID 118352323) has the molecular formula C16H9Cl3N4O3S2 and a molecular weight of 475.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 118352323 |
| Molecular Formula | C16H9Cl3N4O3S2 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1nc([N+](=O)[O-])c(Sc2c(Cl)cncc2Cl)s1 |
| InChI | InChI=1S/C16H9Cl3N4O3S2/c17-9-3-1-8(2-4-9)5-21-14(24)15-22-13(23(25)26)16(28-15)27-12-10(18)6-20-7-11(12)19/h1-4,6-7H,5H2,(H,21,24) |
| InChIKey | RHPLXSDQXIBUBX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|