C14H10Cl2N6O3S2 — CID 68760763
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-ethyltriazol-4-yl)-4-nitrothiophene-2-carboxamide (PubChem CID 68760763) has the molecular formula C14H10Cl2N6O3S2 and a molecular weight of 445.31 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-ethyltriazol-4-yl)-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-ethyltriazol-4-yl)-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68760763 |
| Molecular Formula | C14H10Cl2N6O3S2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(4-ethyltriazol-4-yl)-4-nitrothiophene-2-carboxamide |
| SMILES | CCC1(NC(=O)c2cc([N+](=O)[O-])c(Sc3c(Cl)cncc3Cl)s2)C=NN=N1 |
| InChI | InChI=1S/C14H10Cl2N6O3S2/c1-2-14(6-18-21-20-14)19-12(23)10-3-9(22(24)25)13(26-10)27-11-7(15)4-17-5-8(11)16/h3-6H,2H2,1H3,(H,19,23) |
| InChIKey | JPXJHLXFWVWQNQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|