C16H11Cl2N3O3S3 — CID 46932520
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 46932520) has the molecular formula C16H11Cl2N3O3S3 and a molecular weight of 460.39 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46932520 |
| Molecular Formula | C16H11Cl2N3O3S3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cc([N+](=O)[O-])c(Sc2c(Cl)cncc2Cl)s1 |
| InChI | InChI=1S/C16H11Cl2N3O3S3/c17-10-7-19-8-11(18)14(10)27-16-12(21(23)24)6-13(26-16)15(22)20-4-3-9-2-1-5-25-9/h1-2,5-8H,3-4H2,(H,20,22) |
| InChIKey | XMSAJEALMXHBQY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|