C19H15Cl2N3O4S2 — CID 46932707
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-[(3-methoxyphenyl)methyl]-N-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 46932707) has the molecular formula C19H15Cl2N3O4S2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-[(3-methoxyphenyl)methyl]-N-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-[(3-methoxyphenyl)methyl]-N-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46932707 |
| Molecular Formula | C19H15Cl2N3O4S2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-[(3-methoxyphenyl)methyl]-N-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | COc1cccc(CN(C)C(=O)c2cc([N+](=O)[O-])c(Sc3c(Cl)cncc3Cl)s2)c1 |
| InChI | InChI=1S/C19H15Cl2N3O4S2/c1-23(10-11-4-3-5-12(6-11)28-2)18(25)16-7-15(24(26)27)19(29-16)30-17-13(20)8-22-9-14(17)21/h3-9H,10H2,1-2H3 |
| InChIKey | XPSYBYXKDIMZNS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|