C11H6Cl2N2O4S2 — CID 46932421
methyl 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophene-2-carboxylate (PubChem CID 46932421) has the molecular formula C11H6Cl2N2O4S2 and a molecular weight of 365.22 g/mol. Its IUPAC name is methyl 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophene-2-carboxylate.
| Compound Name | methyl 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46932421 |
| Molecular Formula | C11H6Cl2N2O4S2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 363.91 |
| IUPAC Name | methyl 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophene-2-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Sc2c(Cl)cncc2Cl)s1 |
| InChI | InChI=1S/C11H6Cl2N2O4S2/c1-19-10(16)8-2-7(15(17)18)11(20-8)21-9-5(12)3-14-4-6(9)13/h2-4H,1H3 |
| InChIKey | DMZVIOUGSPCFAB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|