C19H14Cl2N4O4S3 — CID 171356447
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-imino-3-methyl-1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide (PubChem CID 171356447) has the molecular formula C19H14Cl2N4O4S3 and a molecular weight of 529.45 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-imino-3-methyl-1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-imino-3-methyl-1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 171356447 |
| Molecular Formula | C19H14Cl2N4O4S3 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 527.96 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-imino-3-methyl-1-oxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide |
| SMILES | [H]N=S1(=O)CC(C)c2ccc(NC(=O)c3cc([N+](=O)[O-])c(Sc4c(Cl)cncc4Cl)s3)cc21 |
| InChI | InChI=1S/C19H14Cl2N4O4S3/c1-9-8-32(22,29)16-4-10(2-3-11(9)16)24-18(26)15-5-14(25(27)28)19(30-15)31-17-12(20)6-23-7-13(17)21/h2-7,9,22H,8H2,1H3,(H,24,26) |
| InChIKey | OZSIXGYRVPWENG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|