C16H16Cl2N4O3S2 — CID 67495161
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-methylpiperidin-3-yl)-4-nitrothiophene-2-carboxamide (PubChem CID 67495161) has the molecular formula C16H16Cl2N4O3S2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-methylpiperidin-3-yl)-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-methylpiperidin-3-yl)-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 67495161 |
| Molecular Formula | C16H16Cl2N4O3S2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(1-methylpiperidin-3-yl)-4-nitrothiophene-2-carboxamide |
| SMILES | CN1CCCC(NC(=O)c2cc([N+](=O)[O-])c(Sc3c(Cl)cncc3Cl)s2)C1 |
| InChI | InChI=1S/C16H16Cl2N4O3S2/c1-21-4-2-3-9(8-21)20-15(23)13-5-12(22(24)25)16(26-13)27-14-10(17)6-19-7-11(14)18/h5-7,9H,2-4,8H2,1H3,(H,20,23) |
| InChIKey | VPGDUBHVCOHMOD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|