C16H15Cl2N3O4S2 — CID 46932807
[5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophen-2-yl]-[4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 46932807) has the molecular formula C16H15Cl2N3O4S2 and a molecular weight of 448.35 g/mol. Its IUPAC name is [5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophen-2-yl]-[4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophen-2-yl]-[4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46932807 |
| Molecular Formula | C16H15Cl2N3O4S2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | [5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitrothiophen-2-yl]-[4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])c(Sc2c(Cl)cncc2Cl)s1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C16H15Cl2N3O4S2/c17-10-6-19-7-11(18)14(10)27-16-12(21(24)25)5-13(26-16)15(23)20-3-1-9(8-22)2-4-20/h5-7,9,22H,1-4,8H2 |
| InChIKey | UGRADFOBTYUXSD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|