About (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone
(7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 69369255) has the molecular formula C13H13ClN2O2S
and a molecular weight of 296.78 g/mol. Its IUPAC name is (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 69369255 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc2nccc(Cl)c2s1)N1CC[C@H](CO)C1 |
| InChI | InChI=1S/C13H13ClN2O2S/c14-9-1-3-15-10-5-11(19-12(9)10)13(18)16-4-2-8(6-16)7-17/h1,3,5,8,17H,2,4,6-7H2/t8-/m0/s1 |
| InChIKey | AGIIYFRQDNBXNJ-QMMMGPOBSA-N |
| XLogP | 2.40 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The IUPAC name of (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone (CID 69369255) is (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone is O=C(c1cc2nccc(Cl)c2s1)N1CC[C@H](CO)C1.
What is the InChIKey of (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone?
The InChIKey is AGIIYFRQDNBXNJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H13ClN2O2S/c14-9-1-3-15-10-5-11(19-12(9)10)13(18)16-4-2-8(6-16)7-17/h1,3,5,8,17H,2,4,6-7H2/t8-/m0/s1.
What are the key properties of (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone?
(7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone has a molecular weight of 296.78 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chlorothieno[3,2-b]pyridin-2-yl)-[(3S)-3-(hydroxymethyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 69369255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).