C18H20Cl2N4O3S2 — CID 67494835
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(1-propylpiperidin-4-yl)thiophene-2-carboxamide (PubChem CID 67494835) has the molecular formula C18H20Cl2N4O3S2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(1-propylpiperidin-4-yl)thiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(1-propylpiperidin-4-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67494835 |
| Molecular Formula | C18H20Cl2N4O3S2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-4-nitro-N-(1-propylpiperidin-4-yl)thiophene-2-carboxamide |
| SMILES | CCCN1CCC(NC(=O)c2cc([N+](=O)[O-])c(Sc3c(Cl)cncc3Cl)s2)CC1 |
| InChI | InChI=1S/C18H20Cl2N4O3S2/c1-2-5-23-6-3-11(4-7-23)22-17(25)15-8-14(24(26)27)18(28-15)29-16-12(19)9-21-10-13(16)20/h8-11H,2-7H2,1H3,(H,22,25) |
| InChIKey | LCLUNCFCYFMUHI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|