C19H13Cl2N3O5S3 — CID 126559339
5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(3-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide (PubChem CID 126559339) has the molecular formula C19H13Cl2N3O5S3 and a molecular weight of 530.44 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(3-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(3-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126559339 |
| Molecular Formula | C19H13Cl2N3O5S3 |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 528.94 |
| IUPAC Name | 5-[(3,5-dichloro-4-pyridinyl)sulfanyl]-N-(3-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-4-nitrothiophene-2-carboxamide |
| SMILES | CC1CS(=O)(=O)c2cc(NC(=O)c3cc([N+](=O)[O-])c(Sc4c(Cl)cncc4Cl)s3)ccc21 |
| InChI | InChI=1S/C19H13Cl2N3O5S3/c1-9-8-32(28,29)16-4-10(2-3-11(9)16)23-18(25)15-5-14(24(26)27)19(30-15)31-17-12(20)6-22-7-13(17)21/h2-7,9H,8H2,1H3,(H,23,25) |
| InChIKey | YEZAUTQLDFTNCN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|