C29H25F3N4O — CID 118356240
1-(3-cyanophenyl)-N-[3-(1-phenylpentyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 118356240) has the molecular formula C29H25F3N4O and a molecular weight of 502.54 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[3-(1-phenylpentyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-cyanophenyl)-N-[3-(1-phenylpentyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118356240 |
| Molecular Formula | C29H25F3N4O |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[3-(1-phenylpentyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCCCC(c1ccccc1)c1cccc(NC(=O)c2cc(C(F)(F)F)nn2-c2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C29H25F3N4O/c1-2-3-15-25(21-10-5-4-6-11-21)22-12-8-13-23(17-22)34-28(37)26-18-27(29(30,31)32)35-36(26)24-14-7-9-20(16-24)19-33/h4-14,16-18,25H,2-3,15H2,1H3,(H,34,37) |
| InChIKey | ZHUWQHTVOVBPNJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |