C28H21F3N4O3S — CID 174409178
1-(3-cyanophenyl)-N-[4-phenyl-3-(prop-2-enylsulfonylmethyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 174409178) has the molecular formula C28H21F3N4O3S and a molecular weight of 550.56 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-N-[4-phenyl-3-(prop-2-enylsulfonylmethyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-cyanophenyl)-N-[4-phenyl-3-(prop-2-enylsulfonylmethyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174409178 |
| Molecular Formula | C28H21F3N4O3S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 1-(3-cyanophenyl)-N-[4-phenyl-3-(prop-2-enylsulfonylmethyl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | C=CCS(=O)(=O)Cc1cc(NC(=O)c2cc(C(F)(F)F)nn2-c2cccc(C#N)c2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H21F3N4O3S/c1-2-13-39(37,38)18-21-15-22(11-12-24(21)20-8-4-3-5-9-20)33-27(36)25-16-26(28(29,30)31)34-35(25)23-10-6-7-19(14-23)17-32/h2-12,14-16H,1,13,18H2,(H,33,36) |
| InChIKey | ZQDKPCPCHBJOSG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|