C21H25NO3 — CID 118360692
ethyl 2-[(S)-(3-methoxy-4,5-dimethylanilino)-phenylmethyl]prop-2-enoate (PubChem CID 118360692) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 2-[(S)-(3-methoxy-4,5-dimethylanilino)-phenylmethyl]prop-2-enoate.
| Compound Name | ethyl 2-[(S)-(3-methoxy-4,5-dimethylanilino)-phenylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 118360692 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | ethyl 2-[(S)-(3-methoxy-4,5-dimethylanilino)-phenylmethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H](Nc1cc(C)c(C)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-6-25-21(23)16(4)20(17-10-8-7-9-11-17)22-18-12-14(2)15(3)19(13-18)24-5/h7-13,20,22H,4,6H2,1-3,5H3/t20-/m1/s1 |
| InChIKey | RWIURFZRQOFQQO-HXUWFJFHSA-N |
| XLogP | 4.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|