C22H26FNO6 — CID 131974505
ethyl 2-[(S)-(3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoate (PubChem CID 131974505) has the molecular formula C22H26FNO6 and a molecular weight of 419.45 g/mol. Its IUPAC name is ethyl 2-[(S)-(3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(S)-(3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 131974505 |
| Molecular Formula | C22H26FNO6 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | ethyl 2-[(S)-(3-fluoro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H](Nc1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C22H26FNO6/c1-7-30-22(25)13(2)20(14-8-9-17(26-3)16(23)10-14)24-15-11-18(27-4)21(29-6)19(12-15)28-5/h8-12,20,24H,2,7H2,1,3-6H3/t20-/m1/s1 |
| InChIKey | DKURVTLLQGNDAN-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|