C20H22ClNO6 — CID 137456531
2-[(3-chloro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoic acid (PubChem CID 137456531) has the molecular formula C20H22ClNO6 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoic acid.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 137456531 |
| Molecular Formula | C20H22ClNO6 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)-(3,4,5-trimethoxyanilino)methyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(Nc1cc(OC)c(OC)c(OC)c1)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClNO6/c1-11(20(23)24)18(12-6-7-15(25-2)14(21)8-12)22-13-9-16(26-3)19(28-5)17(10-13)27-4/h6-10,18,22H,1H2,2-5H3,(H,23,24) |
| InChIKey | UJTAWWVJMRPHPA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|