C21H27NO2 — CID 11836401
5,5-dimethyl-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)cyclohexane-1,3-dione (PubChem CID 11836401) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 5,5-dimethyl-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11836401 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 5,5-dimethyl-2-(3,3,6,7-tetramethyl-4H-isoquinolin-1-yl)cyclohexane-1,3-dione |
| SMILES | Cc1cc2c(cc1C)C(C1C(=O)CC(C)(C)CC1=O)=NC(C)(C)C2 |
| InChI | InChI=1S/C21H27NO2/c1-12-7-14-9-21(5,6)22-19(15(14)8-13(12)2)18-16(23)10-20(3,4)11-17(18)24/h7-8,18H,9-11H2,1-6H3 |
| InChIKey | ISCFEXMKKDTHNK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|