C15H20N2O2 — CID 118364396
2-[4-(oxolan-3-yl)-3,4-dihydro-2H-quinolin-1-yl]acetamide (PubChem CID 118364396) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[4-(oxolan-3-yl)-3,4-dihydro-2H-quinolin-1-yl]acetamide.
| Compound Name | 2-[4-(oxolan-3-yl)-3,4-dihydro-2H-quinolin-1-yl]acetamide |
|---|---|
| PubChem CID | 118364396 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-[4-(oxolan-3-yl)-3,4-dihydro-2H-quinolin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(C2CCOC2)c2ccccc21 |
| InChI | InChI=1S/C15H20N2O2/c16-15(18)9-17-7-5-12(11-6-8-19-10-11)13-3-1-2-4-14(13)17/h1-4,11-12H,5-10H2,(H2,16,18) |
| InChIKey | OMJYACCUYXKIOJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |