C11H10F3N5O2S — CID 118368617
2-methylsulfinyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 118368617) has the molecular formula C11H10F3N5O2S and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-methylsulfinyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-methylsulfinyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118368617 |
| Molecular Formula | C11H10F3N5O2S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-methylsulfinyl-N-(1-methyltetrazol-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | Cn1nnnc1NC(=O)c1ccc(C(F)(F)F)cc1S(C)=O |
| InChI | InChI=1S/C11H10F3N5O2S/c1-19-10(16-17-18-19)15-9(20)7-4-3-6(11(12,13)14)5-8(7)22(2)21/h3-5H,1-2H3,(H,15,16,18,20) |
| InChIKey | PHLZJKBRTDMDDQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |