C11H9F3N5NaO3S — CID 71813019
sodium [2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-(1-methyltetrazol-5-yl)azanide (PubChem CID 71813019) has the molecular formula C11H9F3N5NaO3S and a molecular weight of 371.28 g/mol. Its IUPAC name is sodium [2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-(1-methyltetrazol-5-yl)azanide.
| Compound Name | sodium [2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-(1-methyltetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 71813019 |
| Molecular Formula | C11H9F3N5NaO3S |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | sodium [2-methylsulfonyl-4-(trifluoromethyl)benzoyl]-(1-methyltetrazol-5-yl)azanide |
| SMILES | Cn1nnnc1[N-]C(=O)c1ccc(C(F)(F)F)cc1S(C)(=O)=O.[Na+] |
| InChI | InChI=1S/C11H10F3N5O3S.Na/c1-19-10(16-17-18-19)15-9(20)7-4-3-6(11(12,13)14)5-8(7)23(2,21)22;/h3-5H,1-2H3,(H,15,16,18,20);/q;+1/p-1 |
| InChIKey | KEORHIUOTCXYAR-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 108.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |