C47H31N3 — CID 118371063
2-(1,10c-dihydropyren-4-yl)-4-[4-(4,6-dihydropyren-1-yl)phenyl]-6-pyridin-3-ylpyrimidine (PubChem CID 118371063) has the molecular formula C47H31N3 and a molecular weight of 637.79 g/mol. Its IUPAC name is 2-(1,10c-dihydropyren-4-yl)-4-[4-(4,6-dihydropyren-1-yl)phenyl]-6-pyridin-3-ylpyrimidine.
| Compound Name | 2-(1,10c-dihydropyren-4-yl)-4-[4-(4,6-dihydropyren-1-yl)phenyl]-6-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 118371063 |
| Molecular Formula | C47H31N3 |
| Molecular Weight | 637.79 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 2-(1,10c-dihydropyren-4-yl)-4-[4-(4,6-dihydropyren-1-yl)phenyl]-6-pyridin-3-ylpyrimidine |
| SMILES | C1=CC2=CC=C3CC=CC4=C3C2C(=C1)C=C4c1nc(-c2ccc(-c3ccc4c5c6c(ccc35)C=CCC6=CC4)cc2)cc(-c2cccnc2)n1 |
| InChI | InChI=1S/C47H31N3/c1-5-30-17-19-34-20-22-37(39-23-21-32(6-1)43(30)46(34)39)28-12-14-29(15-13-28)41-26-42(36-10-4-24-48-27-36)50-47(49-41)40-25-35-9-2-7-31-16-18-33-8-3-11-38(40)45(33)44(31)35/h1-4,6-7,9-18,20-27,44H,5,8,19H2 |
| InChIKey | HSQUVOOYOXROPA-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.79 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |