C23H24F3N7O — CID 118372943
8-methyl-N-[1-(6-methylpyrimidin-4-yl)piperidin-4-yl]-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118372943) has the molecular formula C23H24F3N7O and a molecular weight of 471.49 g/mol. Its IUPAC name is 8-methyl-N-[1-(6-methylpyrimidin-4-yl)piperidin-4-yl]-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | 8-methyl-N-[1-(6-methylpyrimidin-4-yl)piperidin-4-yl]-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118372943 |
| Molecular Formula | C23H24F3N7O |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 8-methyl-N-[1-(6-methylpyrimidin-4-yl)piperidin-4-yl]-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | Cc1cc(N2CCC(Nc3ncc4c(n3)N(C)C(c3cc(F)c(F)c(F)c3)CO4)CC2)ncn1 |
| InChI | InChI=1S/C23H24F3N7O/c1-13-7-20(29-12-28-13)33-5-3-15(4-6-33)30-23-27-10-19-22(31-23)32(2)18(11-34-19)14-8-16(24)21(26)17(25)9-14/h7-10,12,15,18H,3-6,11H2,1-2H3,(H,27,30,31) |
| InChIKey | HIZFRFBGBVSHCZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|