C28H39ClFN5O3S — CID 118373775
(2S,3R)-2-amino-3-(4-chlorophenyl)-N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-5-fluoro-3-pyridinyl]-4-ethylhexanamide (PubChem CID 118373775) has the molecular formula C28H39ClFN5O3S and a molecular weight of 580.17 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-5-fluoro-3-pyridinyl]-4-ethylhexanamide.
| Compound Name | (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-5-fluoro-3-pyridinyl]-4-ethylhexanamide |
|---|---|
| PubChem CID | 118373775 |
| Molecular Formula | C28H39ClFN5O3S |
| Molecular Weight | 580.17 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[4-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-5-fluoro-3-pyridinyl]-4-ethylhexanamide |
| SMILES | CCC(CC)[C@H](c1ccc(Cl)cc1)[C@H](N)C(=O)Nc1cncc(F)c1CC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2 |
| InChI | InChI=1S/C28H39ClFN5O3S/c1-3-18(4-2)26(19-7-9-20(29)10-8-19)27(31)28(36)34-25-16-32-15-24(30)23(25)12-11-22-14-33-21-6-5-13-39(37,38)35(22)17-21/h7-10,15-16,18,21-22,26-27,33H,3-6,11-14,17,31H2,1-2H3,(H,34,36)/t21-,22+,26-,27+/m1/s1 |
| InChIKey | JCEHTNRCHVBPMP-IMIIGWPFSA-N |
| XLogP | 4.06 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |