C31H42ClFN4O4S — CID 138547011
(2S,3R)-2-amino-3-(4-chlorophenyl)-N-[2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]-3-fluorophenyl]-3-(4-hydroxycyclohexyl)propanamide (PubChem CID 138547011) has the molecular formula C31H42ClFN4O4S and a molecular weight of 621.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]-3-fluorophenyl]-3-(4-hydroxycyclohexyl)propanamide.
| Compound Name | (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]-3-fluorophenyl]-3-(4-hydroxycyclohexyl)propanamide |
|---|---|
| PubChem CID | 138547011 |
| Molecular Formula | C31H42ClFN4O4S |
| Molecular Weight | 621.22 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | (2S,3R)-2-amino-3-(4-chlorophenyl)-N-[2-[3-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]propyl]-3-fluorophenyl]-3-(4-hydroxycyclohexyl)propanamide |
| SMILES | N[C@H](C(=O)Nc1cccc(F)c1CCC[C@H]1CN[C@@H]2CCCS(=O)(=O)N1C2)[C@@H](c1ccc(Cl)cc1)C1CCC(O)CC1 |
| InChI | InChI=1S/C31H42ClFN4O4S/c32-22-13-9-20(10-14-22)29(21-11-15-25(38)16-12-21)30(34)31(39)36-28-8-2-7-27(33)26(28)6-1-5-24-18-35-23-4-3-17-42(40,41)37(24)19-23/h2,7-10,13-14,21,23-25,29-30,35,38H,1,3-6,11-12,15-19,34H2,(H,36,39)/t21?,23-,24+,25?,29+,30+/m1/s1 |
| InChIKey | QMKHZFIDSDZGLM-JHFAGAGLSA-N |
| XLogP | 4.17 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |