C30H40F4N4O3S — CID 126664360
(2S,3S)-2-amino-3-(4,4-difluorocyclohexyl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide (PubChem CID 126664360) has the molecular formula C30H40F4N4O3S and a molecular weight of 612.73 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-(4,4-difluorocyclohexyl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S,3S)-2-amino-3-(4,4-difluorocyclohexyl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 126664360 |
| Molecular Formula | C30H40F4N4O3S |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | (2S,3S)-2-amino-3-(4,4-difluorocyclohexyl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
| SMILES | N[C@H](C(=O)Nc1cccc(F)c1CCC1CNC2CCCS(O)(O)N1C2)[C@H](c1ccc(F)cc1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C30H40F4N4O3S/c31-21-8-6-19(7-9-21)27(20-12-14-30(33,34)15-13-20)28(35)29(39)37-26-5-1-4-25(32)24(26)11-10-23-17-36-22-3-2-16-42(40,41)38(23)18-22/h1,4-9,20,22-23,27-28,36,40-41H,2-3,10-18,35H2,(H,37,39)/t22?,23?,27-,28+/m1/s1 |
| InChIKey | ZIAPLOOIVWWIHL-BQFBPARGSA-N |
| XLogP | 5.87 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |